cas: 131690-61-4 — see every product listed under this CAS number, including other names
H-D-β-Phe(4-Cl)-OH 97% (CAS 131690-61-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A431271-100mg |
| cas | 131690-61-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 159.00 Pln | |
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 592.88 Pln | |
| Ambeed | 10g | 1110.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A431271 |
(3R)-3-amino-3-(4-chlorophenyl)propanoic acid (CAS 131690-61-4) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: (3R)-3-amino-3-(4-chlorophenyl)propanoic acid. InChIKey: BXGDBHAMTMMNTO-MRVPVSSYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | (3R)-3-amino-3-(4-chlorophenyl)propanoic acid |
| InChIKey | BXGDBHAMTMMNTO-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](CC(=O)O)N)Cl |
Computed by PubChem (NCBI)