Products 108391-82-8

CAS 108391-82-8 appears in our catalog under these names: 6-Fluoro-d-tryptophan, 95%, (R)-2-Amino-3-(6-fluoro-1H-indol-3-yl)propanoic acid, 97%, (R)–2–Amino–3–(6–fluoro–1H–indol–3–yl)propanoic acid, H-D-Trp(6-F)-OH, 95%. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.

Structural formula: {0} (CAS {1})

(2R)-2-amino-3-(6-fluoro-1H-indol-3-yl)propanoic acid (CAS 108391-82-8) is a chemical compound with the molecular formula C11H11FN2O2 and a molecular weight of 222.22 g/mol. IUPAC name: (2R)-2-amino-3-(6-fluoro-1H-indol-3-yl)propanoic acid. InChIKey: YMEXGEAJNZRQEH-SECBINFHSA-N.

Identity
Molecular formulaC11H11FN2O2
Molecular weight222.22 g/mol
IUPAC name(2R)-2-amino-3-(6-fluoro-1H-indol-3-yl)propanoic acid
InChIKeyYMEXGEAJNZRQEH-SECBINFHSA-N
SMILESC1=CC2=C(C=C1F)NC=C2C[C@H](C(=O)O)N

Computed by PubChem (NCBI)