CAS 108391-82-8 appears in our catalog under these names: 6-Fluoro-d-tryptophan, 95%, (R)-2-Amino-3-(6-fluoro-1H-indol-3-yl)propanoic acid, 97%, (R)–2–Amino–3–(6–fluoro–1H–indol–3–yl)propanoic acid, H-D-Trp(6-F)-OH, 95%. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
(2R)-2-amino-3-(6-fluoro-1H-indol-3-yl)propanoic acid (CAS 108391-82-8) is a chemical compound with the molecular formula C11H11FN2O2 and a molecular weight of 222.22 g/mol. IUPAC name: (2R)-2-amino-3-(6-fluoro-1H-indol-3-yl)propanoic acid. InChIKey: YMEXGEAJNZRQEH-SECBINFHSA-N.
| Molecular formula | C11H11FN2O2 |
|---|---|
| Molecular weight | 222.22 g/mol |
| IUPAC name | (2R)-2-amino-3-(6-fluoro-1H-indol-3-yl)propanoic acid |
| InChIKey | YMEXGEAJNZRQEH-SECBINFHSA-N |
| SMILES | C1=CC2=C(C=C1F)NC=C2C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)