H-D-Trp(7-Br)-OH 97%
cas: 496929-99-8 — see every product listed under this CAS number, including other names
H-D-Trp(7-Br)-OH 97% (CAS 496929-99-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A338992-100mg |
| cas | 496929-99-8 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 409.31 Pln | |
| Ambeed | 250mg | 726.38 Pln | |
| Ambeed | 1g | 1850.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A338992 |
(2R)-2-amino-3-(7-bromo-1H-indol-3-yl)propanoic acid (CAS 496929-99-8) is a chemical compound with the molecular formula C11H11BrN2O2 and a molecular weight of 283.12 g/mol. IUPAC name: (2R)-2-amino-3-(7-bromo-1H-indol-3-yl)propanoic acid. InChIKey: VMMOOBBCGTVDGP-SECBINFHSA-N.
| Molecular formula | C11H11BrN2O2 |
|---|---|
| Molecular weight | 283.12 g/mol |
| IUPAC name | (2R)-2-amino-3-(7-bromo-1H-indol-3-yl)propanoic acid |
| InChIKey | VMMOOBBCGTVDGP-SECBINFHSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)NC=C2C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)