cas: 61535-49-7 — see every product listed under this CAS number, including other names
H-D-Trp-OEt·HCl 97% (CAS 61535-49-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A213156-250mg |
| cas | 61535-49-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 164.56 Pln | |
| Ambeed | 25g | 186.81 Pln | |
| Ambeed | 100g | 325.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A213156 |
Ethyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride (CAS 61535-49-7) is a chemical compound with the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. IUPAC name: ethyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride. InChIKey: PESYCVVSLYSXAK-RFVHGSKJSA-N.
| Molecular formula | C13H17ClN2O2 |
|---|---|
| Molecular weight | 268.74 g/mol |
| IUPAC name | ethyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride |
| InChIKey | PESYCVVSLYSXAK-RFVHGSKJSA-N |
| SMILES | CCOC(=O)[C@@H](CC1=CNC2=CC=CC=C21)N.Cl |
Computed by PubChem (NCBI)