H-D-Tyr(3-I)-OH, 97%
cas: 25799-58-0 — see every product listed under this CAS number, including other names
H-D-Tyr(3-I)-OH, 97% (CAS 25799-58-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11BGGN-100mg |
| cas | 25799-58-0 |
| size | 100mg |
| availability | 500g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 208.40 Pln | |
| Chemat | 5g | 779.60 Pln | |
| Chemat | 10g | 1499.60 Pln | |
| Chemat | 25g | 2699.60 Pln | |
| Chemat | 100g | 8498.00 Pln | |
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 362.39 Pln | |
| Fluorochem | 5g | 1445.34 Pln | |
| Fluorochem | 25g | 5006.59 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoic acid (CAS 25799-58-0) is a chemical compound with the molecular formula C9H10INO3 and a molecular weight of 307.08 g/mol. IUPAC name: (2R)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoic acid. InChIKey: UQTZMGFTRHFAAM-SSDOTTSWSA-N.
| Molecular formula | C9H10INO3 |
|---|---|
| Molecular weight | 307.08 g/mol |
| IUPAC name | (2R)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoic acid |
| InChIKey | UQTZMGFTRHFAAM-SSDOTTSWSA-N |
| SMILES | C1=CC(=C(C=C1C[C@H](C(=O)O)N)I)O |
Computed by PubChem (NCBI)