Products 2483735-06-2
CAS 2483735-06-2 is the registry number for H-Tyr(3-I)-OH-13C6. Offered by: MedChemExpress. Available pack sizes: 5mg, 1mg.
(2S)-2-amino-3-(4-hydroxy-3-iodo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)propanoic acid (CAS 2483735-06-2) is a chemical compound with the molecular formula C9H10INO3 and a molecular weight of 313.04 g/mol. IUPAC name: (2S)-2-amino-3-(4-hydroxy-3-iodo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)propanoic acid. InChIKey: UQTZMGFTRHFAAM-DXQQUZLMSA-N.
| Molecular formula | C9H10INO3 |
|---|---|
| Molecular weight | 313.04 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-hydroxy-3-iodo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)propanoic acid |
| InChIKey | UQTZMGFTRHFAAM-DXQQUZLMSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13C]([13CH]=[13C]1C[C@@H](C(=O)O)N)I)O |
Computed by PubChem (NCBI)
Synonyms:
H-Tyr(3-I)-OH-13C6, 3-Iodo-tyrosine-13C6