CAS 25799-58-0 appears in our catalog under these names: 3-Iodo-D-tyrosine, 97%, 3-Iodo-D-tyrosine, >95% (HPLC), H–D–Tyr(3–I)–OH, 3-Iodo-D-tyrosine, 97%, 97%, H-D-Tyr(3-I)-OH, 97%. Offered by: Combi-blocks, TRC, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 500mg, 100mg, 100g.
(2R)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoic acid (CAS 25799-58-0) is a chemical compound with the molecular formula C9H10INO3 and a molecular weight of 307.08 g/mol. IUPAC name: (2R)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoic acid. InChIKey: UQTZMGFTRHFAAM-SSDOTTSWSA-N.
| Molecular formula | C9H10INO3 |
|---|---|
| Molecular weight | 307.08 g/mol |
| IUPAC name | (2R)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoic acid |
| InChIKey | UQTZMGFTRHFAAM-SSDOTTSWSA-N |
| SMILES | C1=CC(=C(C=C1C[C@H](C(=O)O)N)I)O |
Computed by PubChem (NCBI)