CAS 2365398-43-0 is the registry number for (3S,3Ar,5r,6ar,7r)-6-iodo-2-oxooctahydro-3,5-methanocyclopenta[b]pyrrole-7-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
(1R,7R,9R)-2-iodo-5-oxo-4-azatricyclo[4.2.1.03,7]nonane-9-carboxylic acid (CAS 2365398-43-0) is a chemical compound with the molecular formula C9H10INO3 and a molecular weight of 307.08 g/mol. IUPAC name: (1R,7R,9R)-2-iodo-5-oxo-4-azatricyclo[4.2.1.03,7]nonane-9-carboxylic acid. InChIKey: MUPLXNKKZNASQI-BJSDSKQBSA-N.
| Molecular formula | C9H10INO3 |
|---|---|
| Molecular weight | 307.08 g/mol |
| IUPAC name | (1R,7R,9R)-2-iodo-5-oxo-4-azatricyclo[4.2.1.03,7]nonane-9-carboxylic acid |
| InChIKey | MUPLXNKKZNASQI-BJSDSKQBSA-N |
| SMILES | C1[C@@H]2[C@@H](C3[C@@H]1C(C2I)NC3=O)C(=O)O |
Computed by PubChem (NCBI)