cas: 34993-02-7 — see every product listed under this CAS number, including other names
H-DL-Nva(5-phenyl)-OH 97% (CAS 34993-02-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A136266-100mg |
| cas | 34993-02-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 515.00 Pln | |
| Ambeed | 5g | 1638.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A136266 |
2-amino-5-phenylpentanoic acid (CAS 34993-02-7) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: 2-amino-5-phenylpentanoic acid. InChIKey: XOQZTHUXZWQXOK-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 2-amino-5-phenylpentanoic acid |
| InChIKey | XOQZTHUXZWQXOK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCCC(C(=O)O)N |
Computed by PubChem (NCBI)