CAS 34993-02-7 appears in our catalog under these names: D-2-Amino-5-phenyl-pentanoic acid, 95%, 2-Amino-5-phenylpentanoic acid, 95%, 2–Amino–5–phenylpentanoic acid, 2-Amino-5-phenylpentanoic acid, 97%, 97%, H-DL-Nva(5-phenyl)-OH, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Ambeed. Available pack sizes: 250mg, 5g, 1g, 10g, 25g, 100mg.
2-amino-5-phenylpentanoic acid (CAS 34993-02-7) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: 2-amino-5-phenylpentanoic acid. InChIKey: XOQZTHUXZWQXOK-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 2-amino-5-phenylpentanoic acid |
| InChIKey | XOQZTHUXZWQXOK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCCC(C(=O)O)N |
Computed by PubChem (NCBI)