H-DL-Trp(6-OMe)-OH 98%
cas: 33600-67-8 — see every product listed under this CAS number, including other names
H-DL-Trp(6-OMe)-OH 98% (CAS 33600-67-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A133894-100mg |
| cas | 33600-67-8 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 492.75 Pln | |
| Ambeed | 250mg | 876.56 Pln | |
| Ambeed | 1g | 2250.50 Pln | |
| Ambeed | 5g | 7673.94 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A133894 |
2-amino-3-(6-methoxy-1H-indol-3-yl)propanoic acid (CAS 33600-67-8) is a chemical compound with the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. IUPAC name: 2-amino-3-(6-methoxy-1H-indol-3-yl)propanoic acid. InChIKey: ASMBUJRMSWTSLE-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O3 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 2-amino-3-(6-methoxy-1H-indol-3-yl)propanoic acid |
| InChIKey | ASMBUJRMSWTSLE-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=CN2)CC(C(=O)O)N |
Computed by PubChem (NCBI)