cas: 181518-87-6 — see every product listed under this CAS number, including other names
H-Dab(Me2)-OH 95% (CAS 181518-87-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A382119-5g |
| cas | 181518-87-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 11067.06 Pln | |
| Ambeed | 10g | 17669.75 Pln | |
| Ambeed | 100mg | 854.31 Pln | |
| Ambeed | 250mg | 1432.81 Pln | |
| Ambeed | 1g | 3212.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A382119 |
(2S)-4-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 181518-87-6) is a chemical compound with the molecular formula C11H22N2O4 and a molecular weight of 246.30 g/mol. IUPAC name: (2S)-4-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: YEKMUOMXRLSQDM-QMMMGPOBSA-N.
| Molecular formula | C11H22N2O4 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | (2S)-4-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | YEKMUOMXRLSQDM-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCN(C)C)C(=O)O |
Computed by PubChem (NCBI)