cas: 26462-22-6 — see every product listed under this CAS number, including other names
H-Ile-Leu-OH, 95%, 95% (CAS 26462-22-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113TBO-100mg |
| cas | 26462-22-6 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 453.20 Pln | |
| Chemat | 250mg | 746.00 Pln | |
| Chemat | 1g | 2795.60 Pln | |
| Chemat | 5g | 11003.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ile-Leu is a dipeptide formed from L-isoleucine and L-leucine residues. It has a role as a metabolite. It is a tautomer of an Ile-Leu zwitterion.
Source: ChEBI
| Molecular formula | C12H24N2O3 |
|---|---|
| Molecular weight | 244.33 g/mol |
| IUPAC name | (2S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-4-methylpentanoic acid |
| InChIKey | JWBXCSQZLLIOCI-GUBZILKMSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)O)N |
Computed by PubChem (NCBI)