cas: 69320-89-4 — see every product listed under this CAS number, including other names
H-Ile-OtBu.HCl 98% (CAS 69320-89-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A104417-250mg |
| cas | 69320-89-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 136.75 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 531.69 Pln | |
| Ambeed | 500g | 2367.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A104417 |
Tert-butyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride (CAS 69320-89-4) is a chemical compound with the molecular formula C10H22ClNO2 and a molecular weight of 223.74 g/mol. IUPAC name: tert-butyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride. InChIKey: IFRYMHOZFAPYPJ-WSZWBAFRSA-N.
| Molecular formula | C10H22ClNO2 |
|---|---|
| Molecular weight | 223.74 g/mol |
| IUPAC name | tert-butyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride |
| InChIKey | IFRYMHOZFAPYPJ-WSZWBAFRSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)