cas: 36077-41-5 — see every product listed under this CAS number, including other names
H-Leu-Ile-OH 95% (CAS 36077-41-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A119120-100mg |
| cas | 36077-41-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 192.38 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 620.69 Pln | |
| Ambeed | 5g | 1327.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A119120 |
2-[(2-amino-4-methylpentanoyl)amino]-3-methylpentanoic acid (CAS 36077-41-5) is a chemical compound with the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. IUPAC name: 2-[(2-amino-4-methylpentanoyl)amino]-3-methylpentanoic acid. InChIKey: AZLASBBHHSLQDB-UHFFFAOYSA-N.
| Molecular formula | C12H24N2O3 |
|---|---|
| Molecular weight | 244.33 g/mol |
| IUPAC name | 2-[(2-amino-4-methylpentanoyl)amino]-3-methylpentanoic acid |
| InChIKey | AZLASBBHHSLQDB-UHFFFAOYSA-N |
| SMILES | CCC(C)C(C(=O)O)NC(=O)C(CC(C)C)N |
Computed by PubChem (NCBI)