cas: 2743-40-0 — see every product listed under this CAS number, including other names
H-Leu-OEt.HCl 97% (CAS 2743-40-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A310551-25g |
| cas | 2743-40-0 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 147.88 Pln | |
| Ambeed | 100g | 259.12 Pln | |
| Ambeed | 500g | 809.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A310551 |
Ethyl (2S)-2-amino-4-methylpentanoate;hydrochloride (CAS 2743-40-0) is a chemical compound with the molecular formula C8H18ClNO2 and a molecular weight of 195.69 g/mol. IUPAC name: ethyl (2S)-2-amino-4-methylpentanoate;hydrochloride. InChIKey: NOUDPBCEONUCOV-FJXQXJEOSA-N.
| Molecular formula | C8H18ClNO2 |
|---|---|
| Molecular weight | 195.69 g/mol |
| IUPAC name | ethyl (2S)-2-amino-4-methylpentanoate;hydrochloride |
| InChIKey | NOUDPBCEONUCOV-FJXQXJEOSA-N |
| SMILES | CCOC(=O)[C@H](CC(C)C)N.Cl |
Computed by PubChem (NCBI)