CAS 3339-45-5 appears in our catalog under these names: methyl (2S)-4-methyl-2-(methylamino)pentanoate hydrochloride, 95%, (S)–Methyl 4–methyl–2–(methylamino)pentanoate hydrochloride, Methyl N-methyl-L-leucinate hydrochloride, 95%, 95%, METHYL (2S)-4-METHYL-2-(METHYLAMINO)PENTANOATE HYDROCHLORIDE, 96%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
Methyl (2S)-4-methyl-2-(methylamino)pentanoate;hydrochloride (CAS 3339-45-5) is a chemical compound with the molecular formula C8H18ClNO2 and a molecular weight of 195.69 g/mol. IUPAC name: methyl (2S)-4-methyl-2-(methylamino)pentanoate;hydrochloride. InChIKey: VKYPGIMVFQAVJF-FJXQXJEOSA-N.
| Molecular formula | C8H18ClNO2 |
|---|---|
| Molecular weight | 195.69 g/mol |
| IUPAC name | methyl (2S)-4-methyl-2-(methylamino)pentanoate;hydrochloride |
| InChIKey | VKYPGIMVFQAVJF-FJXQXJEOSA-N |
| SMILES | CC(C)C[C@@H](C(=O)OC)NC.Cl |
Computed by PubChem (NCBI)