Products 1820741-04-5

CAS 1820741-04-5 is the registry number for methyl 2-amino-2,3,3-trimethylbutanoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Methyl 2-amino-2,3,3-trimethylbutanoate;hydrochloride (CAS 1820741-04-5) is a chemical compound with the molecular formula C8H18ClNO2 and a molecular weight of 195.69 g/mol. IUPAC name: methyl 2-amino-2,3,3-trimethylbutanoate;hydrochloride. InChIKey: WVWGJKKEOLFTTN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H18ClNO2
Molecular weight195.69 g/mol
IUPAC namemethyl 2-amino-2,3,3-trimethylbutanoate;hydrochloride
InChIKeyWVWGJKKEOLFTTN-UHFFFAOYSA-N
SMILESCC(C)(C)C(C)(C(=O)OC)N.Cl

Computed by PubChem (NCBI)