CAS 1820741-04-5 is the registry number for methyl 2-amino-2,3,3-trimethylbutanoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 2-amino-2,3,3-trimethylbutanoate;hydrochloride (CAS 1820741-04-5) is a chemical compound with the molecular formula C8H18ClNO2 and a molecular weight of 195.69 g/mol. IUPAC name: methyl 2-amino-2,3,3-trimethylbutanoate;hydrochloride. InChIKey: WVWGJKKEOLFTTN-UHFFFAOYSA-N.
| Molecular formula | C8H18ClNO2 |
|---|---|
| Molecular weight | 195.69 g/mol |
| IUPAC name | methyl 2-amino-2,3,3-trimethylbutanoate;hydrochloride |
| InChIKey | WVWGJKKEOLFTTN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C)(C(=O)OC)N.Cl |
Computed by PubChem (NCBI)