Products 945419-79-4

CAS 945419-79-4 is the registry number for Ethyl 3-aminohexanoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 3-aminohexanoate;hydrochloride (CAS 945419-79-4) is a chemical compound with the molecular formula C8H18ClNO2 and a molecular weight of 195.69 g/mol. IUPAC name: ethyl 3-aminohexanoate;hydrochloride. InChIKey: RJNLWXVORNLJGW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H18ClNO2
Molecular weight195.69 g/mol
IUPAC nameethyl 3-aminohexanoate;hydrochloride
InChIKeyRJNLWXVORNLJGW-UHFFFAOYSA-N
SMILESCCCC(CC(=O)OCC)N.Cl

Computed by PubChem (NCBI)