H-Leu-OtBu.HCl, 95%
cas: 2748-02-9 — see every product listed under this CAS number, including other names
H-Leu-OtBu.HCl, 95% (CAS 2748-02-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 5g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | M03065-1G |
| cas | 2748-02-9 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 10g | 102.07 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 25g | 154.13 Pln | |
| Fluorochem | 100g | 325.94 Pln | |
| Fluorochem | 500g | 1408.90 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl (2S)-2-amino-4-methylpentanoate;hydrochloride (CAS 2748-02-9) is a chemical compound with the molecular formula C10H22ClNO2 and a molecular weight of 223.74 g/mol. IUPAC name: tert-butyl (2S)-2-amino-4-methylpentanoate;hydrochloride. InChIKey: RFUWRXIYTQGFGA-QRPNPIFTSA-N.
| Molecular formula | C10H22ClNO2 |
|---|---|
| Molecular weight | 223.74 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-4-methylpentanoate;hydrochloride |
| InChIKey | RFUWRXIYTQGFGA-QRPNPIFTSA-N |
| SMILES | CC(C)C[C@@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
H-Leu-OtBu.HCl, L-Leucine tert-butyl ester hydrochloride, H-LEU-OTBU HCL, L-Leucine t-butyl ester hydrochloride, L-Leucine tert-butyl ester HCl, tert-Butyl L-Leucinate hydrochloride, H-Leu-OtBu hydrochloride, (S)-tert-Butyl 2-amino-4-methylpentanoate hydrochloride, leucine t-butyl ester hydrochloride, L-leucin-tert.-butylester-hydrochloride