H-Orn(Fmoc)-OH, 95%
cas: 147071-84-9 — see every product listed under this CAS number, including other names
H-Orn(Fmoc)-OH, 95% (CAS 147071-84-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A172205-100mg |
| cas | 147071-84-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 131.19 Pln | |
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 337.00 Pln | |
| Ambeed | 25g | 982.25 Pln | |
| Ambeed | 100g | 2984.75 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 213.20 Pln | |
| Chemat | 25g | 813.20 Pln | |
| Chemat | 100g | 2459.60 Pln | |
| BLDpharm | 100mg | 125.54 Pln | |
| BLDpharm | 250mg | 136.64 Pln | |
| BLDpharm | 1g | 158.86 Pln | |
| BLDpharm | 5g | 353.23 Pln | |
| BLDpharm | 25g | 1052.99 Pln | |
| BLDpharm | 100g | 3213.34 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-2-amino-5-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (CAS 147071-84-9) is a chemical compound with the molecular formula C20H22N2O4 and a molecular weight of 354.4 g/mol. IUPAC name: (2S)-2-amino-5-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid. InChIKey: UZQSWMYLYLRAMJ-SFHVURJKSA-N.
| Molecular formula | C20H22N2O4 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | (2S)-2-amino-5-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
| InChIKey | UZQSWMYLYLRAMJ-SFHVURJKSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
H-Orn(Fmoc)-OH, Nd-Fmoc-L-ornithine, L-Ornithine, N5-[(9H-fluoren-9-ylmethoxy)carbonyl]-, (2S)-2-amino-5-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic Acid, (2S)-2-azaniumyl-5-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoate, L-Orn(Fmoc)-OH, ORNITHINE(FMOC)-OH, N^d-FMoc-L-ornithine, 95%, N-DELTA-FMOC-L-ORNITHINE, Ndelta-Fmoc-L-ornithine>/= 99% (HPLC)
