CAS 147071-84-9 appears in our catalog under these names: H–Orn(Fmoc)–OH, H-Orn(Fmoc)-OH 95%, H-Orn(Fmoc)-OH, 95%, 95%, Nd-Fmoc-L-ornithine, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 25g, 100g, 10g.
(2S)-2-amino-5-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (CAS 147071-84-9) is a chemical compound with the molecular formula C20H22N2O4 and a molecular weight of 354.4 g/mol. IUPAC name: (2S)-2-amino-5-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid. InChIKey: UZQSWMYLYLRAMJ-SFHVURJKSA-N.
| Molecular formula | C20H22N2O4 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | (2S)-2-amino-5-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
| InChIKey | UZQSWMYLYLRAMJ-SFHVURJKSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)