CAS 19310-00-0 appears in our catalog under these names: (S)-2-Amino-3-(6-fluoro-1h-indol-3-yl)propanoic acid, 95%, (S)–2–Amino–3–(6–fluoro–1H–indol–3–yl)propanoic acid, 6-Fluorotryptophan, (S)-2-Amino-3-(6-fluoro-1H-indol-3-yl)propanoic acid, 95%, 95%, 6-Fluorotryptophan, min. 95 %, 25 mg. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Roth. Available pack sizes: 250mg, 1g, 5g, 25mg, 50mg, 100mg, 500mg.
(2S)-2-amino-3-(6-fluoro-1H-indol-3-yl)propanoic acid (CAS 19310-00-0) is a chemical compound with the molecular formula C11H11FN2O2 and a molecular weight of 222.22 g/mol. IUPAC name: (2S)-2-amino-3-(6-fluoro-1H-indol-3-yl)propanoic acid. InChIKey: YMEXGEAJNZRQEH-VIFPVBQESA-N.
| Molecular formula | C11H11FN2O2 |
|---|---|
| Molecular weight | 222.22 g/mol |
| IUPAC name | (2S)-2-amino-3-(6-fluoro-1H-indol-3-yl)propanoic acid |
| InChIKey | YMEXGEAJNZRQEH-VIFPVBQESA-N |
| SMILES | C1=CC2=C(C=C1F)NC=C2C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)