H-Val-Ala-OH, 97%
cas: 27493-61-4 — see every product listed under this CAS number, including other names
H-Val-Ala-OH, 97% (CAS 27493-61-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 50g. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A154834-250mg |
| cas | 27493-61-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 353.69 Pln | |
| Ambeed | 10g | 492.75 Pln | |
| Ambeed | 25g | 1071.25 Pln | |
| Ambeed | 100g | 3363.00 Pln | |
| Ambeed | 500g | 13236.44 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 208.40 Pln | |
| Chemat | 10g | 338.00 Pln | |
| Chemat | 25g | 717.20 Pln | |
| Chemat | 50g | 1235.60 Pln | |
| Chemat | 100g | 2128.40 Pln | |
| Chemat | 250g | 4542.80 Pln | |
| Chemat | 1kg | 6078.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Val-Ala is a dipeptide formed from L-valine and L-alanine residues. It has a role as a metabolite.
Source: ChEBI
| Molecular formula | C8H16N2O3 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]propanoic acid |
| InChIKey | HSRXSKHRSXRCFC-WDSKDSINSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)[C@H](C(C)C)N |
Computed by PubChem (NCBI)
