cas: 40126-30-5 — see every product listed under this CAS number, including other names
H-cis-Hyp-OMe·HCl 97% (CAS 40126-30-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A382474-100mg |
| cas | 40126-30-5 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 10g | 348.12 Pln | |
| Ambeed | 25g | 570.62 Pln | |
| Ambeed | 100g | 1727.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A382474 |
Methyl (2S,4S)-4-hydroxypyrrolidine-2-carboxylate;hydrochloride (CAS 40126-30-5) is a chemical compound with the molecular formula C6H12ClNO3 and a molecular weight of 181.62 g/mol. IUPAC name: methyl (2S,4S)-4-hydroxypyrrolidine-2-carboxylate;hydrochloride. InChIKey: KLGSHNXEUZOKHH-FHAQVOQBSA-N.
| Molecular formula | C6H12ClNO3 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | methyl (2S,4S)-4-hydroxypyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | KLGSHNXEUZOKHH-FHAQVOQBSA-N |
| SMILES | COC(=O)[C@@H]1C[C@@H](CN1)O.Cl |
Computed by PubChem (NCBI)