CAS 481704-21-6 appears in our catalog under these names: tans–4–Hydroxy–D–proline methyl ester hydrochloride, H-D-Hyp-OMe HCl 97%, (2R,4S)-Methyl 4-hydroxypyrrolidine-2-carboxylate hydrochloride, 98%, 98%, (4S)-4-Hydroxy-D-proline methyl ester (hydrochloride), 98.0%, (2R,4S)-Methyl 4-hydroxypyrrolidine-2-carboxylate hydrochloride, 98%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g, 25g, 100g, 100mg.
Methyl (2R,4S)-4-hydroxypyrrolidine-2-carboxylate;hydrochloride (CAS 481704-21-6) is a chemical compound with the molecular formula C6H12ClNO3 and a molecular weight of 181.62 g/mol. IUPAC name: methyl (2R,4S)-4-hydroxypyrrolidine-2-carboxylate;hydrochloride. InChIKey: KLGSHNXEUZOKHH-UYXJWNHNSA-N.
| Molecular formula | C6H12ClNO3 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | methyl (2R,4S)-4-hydroxypyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | KLGSHNXEUZOKHH-UYXJWNHNSA-N |
| SMILES | COC(=O)[C@H]1C[C@@H](CN1)O.Cl |
Computed by PubChem (NCBI)