CAS 156840-13-0 appears in our catalog under these names: HBC 530, HBC/ 98.07% (existing batch purity), HBC, 4-(1-Cyano-2-(4-((2-hydroxyethyl)(methyl)amino)phenyl)vinyl)benzonitrile, ≥98%(HPLC), ≥98%(HPLC), HBC, 99.36%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 60ug, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 50 mg.
4-[(E)-1-cyano-2-[4-[2-hydroxyethyl(methyl)amino]phenyl]ethenyl]benzonitrile (CAS 156840-13-0) is a chemical compound with the molecular formula C19H17N3O and a molecular weight of 303.4 g/mol. IUPAC name: 4-[(E)-1-cyano-2-[4-[2-hydroxyethyl(methyl)amino]phenyl]ethenyl]benzonitrile. InChIKey: DIAVZHWDYXQAFC-PDGQHHTCSA-N.
| Molecular formula | C19H17N3O |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | 4-[(E)-1-cyano-2-[4-[2-hydroxyethyl(methyl)amino]phenyl]ethenyl]benzonitrile |
| InChIKey | DIAVZHWDYXQAFC-PDGQHHTCSA-N |
| SMILES | CN(CCO)C1=CC=C(C=C1)/C=C(/C#N)\C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)