CAS 2075787-77-6 appears in our catalog under these names: HDAC-IN-52/ 98.5% (existing batch purity), HDAC–IN–52, HDAC-IN-52, 99.46%, N-(2-Aminophenyl)-5-(2-(naphthalen-2-yl)acetamido)picolinamide, 95%, 95%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10 mg.
N-(2-aminophenyl)-5-[(2-naphthalen-2-ylacetyl)amino]pyridine-2-carboxamide (CAS 2075787-77-6) is a chemical compound with the molecular formula C24H20N4O2 and a molecular weight of 396.4 g/mol. IUPAC name: N-(2-aminophenyl)-5-[(2-naphthalen-2-ylacetyl)amino]pyridine-2-carboxamide. InChIKey: MOHPPFRGEVZIHW-UHFFFAOYSA-N.
| Molecular formula | C24H20N4O2 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | N-(2-aminophenyl)-5-[(2-naphthalen-2-ylacetyl)amino]pyridine-2-carboxamide |
| InChIKey | MOHPPFRGEVZIHW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)CC(=O)NC3=CN=C(C=C3)C(=O)NC4=CC=CC=C4N |
Computed by PubChem (NCBI)