CAS 13728-56-8 appears in our catalog under these names: HIV–1 Nef–IN–1, HIV-1 Nef-IN-1/ 99.62% (existing batch purity), 3-Phenanthrenebutyric acid, HIV-1 Nef-IN-1, 99%, 99%, HIV-1 Nef-IN-1, 98.60%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 250mg, 10 mg.
4-phenanthren-3-ylbutanoic acid (CAS 13728-56-8) is a chemical compound with the molecular formula C18H16O2 and a molecular weight of 264.3 g/mol. IUPAC name: 4-phenanthren-3-ylbutanoic acid. InChIKey: NYIVWTWKIQOBKO-UHFFFAOYSA-N.
| Molecular formula | C18H16O2 |
|---|---|
| Molecular weight | 264.3 g/mol |
| IUPAC name | 4-phenanthren-3-ylbutanoic acid |
| InChIKey | NYIVWTWKIQOBKO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C=C(C=C3)CCCC(=O)O |
Computed by PubChem (NCBI)