CAS 2581165-97-9 is the registry number for Benzhydryl cyclobut-1-ene-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzhydryl cyclobutene-1-carboxylate (CAS 2581165-97-9) is a chemical compound with the molecular formula C18H16O2 and a molecular weight of 264.3 g/mol. IUPAC name: benzhydryl cyclobutene-1-carboxylate. InChIKey: SFPYCWVLWZPFSB-UHFFFAOYSA-N.
| Molecular formula | C18H16O2 |
|---|---|
| Molecular weight | 264.3 g/mol |
| IUPAC name | benzhydryl cyclobutene-1-carboxylate |
| InChIKey | SFPYCWVLWZPFSB-UHFFFAOYSA-N |
| SMILES | C1CC(=C1)C(=O)OC(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)