Products 55994-21-3
CAS 55994-21-3 is the registry number for 2-(4-Isopropylphenyl)-1H-indene-1,3(2H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-propan-2-ylphenyl)indene-1,3-dione (CAS 55994-21-3) is a chemical compound with the molecular formula C18H16O2 and a molecular weight of 264.3 g/mol. IUPAC name: 2-(4-propan-2-ylphenyl)indene-1,3-dione. InChIKey: ACXYEBDGCHJPON-UHFFFAOYSA-N.
| Molecular formula | C18H16O2 |
|---|---|
| Molecular weight | 264.3 g/mol |
| IUPAC name | 2-(4-propan-2-ylphenyl)indene-1,3-dione |
| InChIKey | ACXYEBDGCHJPON-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)