CAS 15433-03-1 is the registry number for 2-Mesityl-1H-indene-1,3(2H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,4,6-trimethylphenyl)indene-1,3-dione (CAS 15433-03-1) is a chemical compound with the molecular formula C18H16O2 and a molecular weight of 264.3 g/mol. IUPAC name: 2-(2,4,6-trimethylphenyl)indene-1,3-dione. InChIKey: YETKCQKJSSIDGC-UHFFFAOYSA-N.
| Molecular formula | C18H16O2 |
|---|---|
| Molecular weight | 264.3 g/mol |
| IUPAC name | 2-(2,4,6-trimethylphenyl)indene-1,3-dione |
| InChIKey | YETKCQKJSSIDGC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C2C(=O)C3=CC=CC=C3C2=O)C |
Computed by PubChem (NCBI)