cas: 936-05-0 — see every product listed under this CAS number, including other names
HMMNI, 99.91% (CAS 936-05-0) is a chemical reagent available from Chemat. Available pack sizes: 100 mg, 50 g, 25 g, 10mM/1mL, 10 g, 100 g, 1 g, 500 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W008216-100 mg |
| cas | 936-05-0 |
| size | 100 mg |
| availability | In stock |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 mg | 240.74 Pln | |
| MedChemExpress | 50 g | 3287.21 Pln | |
| MedChemExpress | 25 g | 2544.17 Pln | |
| MedChemExpress | 10mM/1mL | 254.68 Pln | |
| MedChemExpress | 10 g | 1731.47 Pln | |
| MedChemExpress | 100 g | 4243.87 Pln | |
| MedChemExpress | 1 g | 579.76 Pln | |
| MedChemExpress | 500 mg | 407.93 Pln | |
| MedChemExpress | 5 g | 1271.71 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.91% |
(1-methyl-5-nitroimidazol-2-yl)methanol (CAS 936-05-0) is a chemical compound with the molecular formula C5H7N3O3 and a molecular weight of 157.13 g/mol. IUPAC name: (1-methyl-5-nitroimidazol-2-yl)methanol. InChIKey: JSAQDPJIVQMBAY-UHFFFAOYSA-N.
| Molecular formula | C5H7N3O3 |
|---|---|
| Molecular weight | 157.13 g/mol |
| IUPAC name | (1-methyl-5-nitroimidazol-2-yl)methanol |
| InChIKey | JSAQDPJIVQMBAY-UHFFFAOYSA-N |
| SMILES | CN1C(=CN=C1CO)[N+](=O)[O-] |
Computed by PubChem (NCBI)