CAS 936-05-0 appears in our catalog under these names: Hydroxy Dimetridazole, Hydroxy Dimetridazole, >95% (HPLC), Dimetridazole-2-hydroxy, Dimetridazole-2-hydroxy 100 µg/mL in Acetone, (1-Methyl-5-nitroimidazol-2-yl)methanol. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, Mikromol, TargetMol. Available pack sizes: on request, 10mg, 50mg, 5mg, 1ml, 25mg, 100mg, 500mg.
(1-methyl-5-nitroimidazol-2-yl)methanol (CAS 936-05-0) is a chemical compound with the molecular formula C5H7N3O3 and a molecular weight of 157.13 g/mol. IUPAC name: (1-methyl-5-nitroimidazol-2-yl)methanol. InChIKey: JSAQDPJIVQMBAY-UHFFFAOYSA-N.
| Molecular formula | C5H7N3O3 |
|---|---|
| Molecular weight | 157.13 g/mol |
| IUPAC name | (1-methyl-5-nitroimidazol-2-yl)methanol |
| InChIKey | JSAQDPJIVQMBAY-UHFFFAOYSA-N |
| SMILES | CN1C(=CN=C1CO)[N+](=O)[O-] |
Computed by PubChem (NCBI)