CAS 2133499-85-9 appears in our catalog under these names: HSP27 inhibitor J2/ 98%, HSP27 inhibitor J2, Hsp27 inhibitor J2, HSP27 inhibitor J2 98+%, 5-Hydroxy-2-methyl-7-(thiiran-2-ylmethoxy)-4H-chromen-4-one, 98+%, 98+%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
5-hydroxy-2-methyl-7-(thiiran-2-ylmethoxy)chromen-4-one (CAS 2133499-85-9) is a chemical compound with the molecular formula C13H12O4S and a molecular weight of 264.30 g/mol. IUPAC name: 5-hydroxy-2-methyl-7-(thiiran-2-ylmethoxy)chromen-4-one. InChIKey: VDCWAGBPDCXRDU-UHFFFAOYSA-N.
| Molecular formula | C13H12O4S |
|---|---|
| Molecular weight | 264.30 g/mol |
| IUPAC name | 5-hydroxy-2-methyl-7-(thiiran-2-ylmethoxy)chromen-4-one |
| InChIKey | VDCWAGBPDCXRDU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C2=C(C=C(C=C2O1)OCC3CS3)O |
Computed by PubChem (NCBI)