Products 136765-35-0
CAS 136765-35-0 appears in our catalog under these names: Haloperidol-D4, Haloperidol-D4, 0.1mg/ml in Methanol, Haloperidol-D4, 1mg/ml in Methanol, Haloperidol (D4'), Haloperidol–d4–1. Offered by: Lipomed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 50mg, 100mg, 10mg, 1ml, 1mg, 5mg, 1 mg, 5 mg.
4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-1-(2,3,5,6-tetradeuterio-4-fluorophenyl)butan-1-one (CAS 136765-35-0) is a chemical compound with the molecular formula C21H23ClFNO2 and a molecular weight of 379.9 g/mol. IUPAC name: 4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-1-(2,3,5,6-tetradeuterio-4-fluorophenyl)butan-1-one. InChIKey: LNEPOXFFQSENCJ-AKPGVGPLSA-N.
| Molecular formula | C21H23ClFNO2 |
|---|---|
| Molecular weight | 379.9 g/mol |
| IUPAC name | 4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-1-(2,3,5,6-tetradeuterio-4-fluorophenyl)butan-1-one |
| InChIKey | LNEPOXFFQSENCJ-AKPGVGPLSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)CCCN2CCC(CC2)(C3=CC=C(C=C3)Cl)O)[2H])[2H])F)[2H] |
Computed by PubChem (NCBI)