CAS 890605-54-6 appears in our catalog under these names: Heclin/ 99.25% (existing batch purity), Heclin, Heclin 97%, Heclin, 97%, 97%, Heclin, 98.21%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1mg, 250mg.
(E)-N-(4-acetylphenyl)-3-(5-ethylfuran-2-yl)prop-2-enamide (CAS 890605-54-6) is a chemical compound with the molecular formula C17H17NO3 and a molecular weight of 283.32 g/mol. IUPAC name: (E)-N-(4-acetylphenyl)-3-(5-ethylfuran-2-yl)prop-2-enamide. InChIKey: SPTWXRJNCFIDRQ-ZHACJKMWSA-N.
| Molecular formula | C17H17NO3 |
|---|---|
| Molecular weight | 283.32 g/mol |
| IUPAC name | (E)-N-(4-acetylphenyl)-3-(5-ethylfuran-2-yl)prop-2-enamide |
| InChIKey | SPTWXRJNCFIDRQ-ZHACJKMWSA-N |
| SMILES | CCC1=CC=C(O1)/C=C/C(=O)NC2=CC=C(C=C2)C(=O)C |
Computed by PubChem (NCBI)