CAS 203935-39-1 appears in our catalog under these names: Helioxanthin derivative 5-4-2/ 99.91% (existing batch purity), Helioxanthin derivative 5–4–2, Helioxanthin derivative 5-4-2, Helioxanthin derivative 5-4-2, 99.80%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 1 mg.
10-(1,3-benzodioxol-5-yl)-8,9-dihydro-[1,3]benzodioxolo[7,6-f]isoindol-7-one (CAS 203935-39-1) is a chemical compound with the molecular formula C20H13NO5 and a molecular weight of 347.3 g/mol. IUPAC name: 10-(1,3-benzodioxol-5-yl)-8,9-dihydro-[1,3]benzodioxolo[7,6-f]isoindol-7-one. InChIKey: UVKXTQRJKHBAMT-UHFFFAOYSA-N.
| Molecular formula | C20H13NO5 |
|---|---|
| Molecular weight | 347.3 g/mol |
| IUPAC name | 10-(1,3-benzodioxol-5-yl)-8,9-dihydro-[1,3]benzodioxolo[7,6-f]isoindol-7-one |
| InChIKey | UVKXTQRJKHBAMT-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C3C=CC4=C(C3=C2C5=CC6=C(C=C5)OCO6)OCO4)C(=O)N1 |
Computed by PubChem (NCBI)