CAS 1031206-36-6 appears in our catalog under these names: IMS 2186, IMS2186/ 99.79% (existing batch purity), IMS2186, IMS2186, 98%, 98%, IMS2186, 99.96%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 100mg, 500mg.
(3E)-3-[(3-hydroxy-4-methoxyphenyl)methylidene]-6-methylchromen-4-one (CAS 1031206-36-6) is a chemical compound with the molecular formula C18H16O4 and a molecular weight of 296.3 g/mol. IUPAC name: (3E)-3-[(3-hydroxy-4-methoxyphenyl)methylidene]-6-methylchromen-4-one. InChIKey: BZCADTHMZLYKAR-MDWZMJQESA-N.
| Molecular formula | C18H16O4 |
|---|---|
| Molecular weight | 296.3 g/mol |
| IUPAC name | (3E)-3-[(3-hydroxy-4-methoxyphenyl)methylidene]-6-methylchromen-4-one |
| InChIKey | BZCADTHMZLYKAR-MDWZMJQESA-N |
| SMILES | CC1=CC2=C(C=C1)OC/C(=C\C3=CC(=C(C=C3)OC)O)/C2=O |
Computed by PubChem (NCBI)