CAS 5217-88-9 is the registry number for 7-Methoxy-3-(4’-methoxyphenyl)-4-methylcoumarin, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-methoxy-3-(4-methoxyphenyl)-4-methylchromen-2-one (CAS 5217-88-9) is a chemical compound with the molecular formula C18H16O4 and a molecular weight of 296.3 g/mol. IUPAC name: 7-methoxy-3-(4-methoxyphenyl)-4-methylchromen-2-one. InChIKey: QKTZSGVZWBCCAP-UHFFFAOYSA-N.
| Molecular formula | C18H16O4 |
|---|---|
| Molecular weight | 296.3 g/mol |
| IUPAC name | 7-methoxy-3-(4-methoxyphenyl)-4-methylchromen-2-one |
| InChIKey | QKTZSGVZWBCCAP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC2=C1C=CC(=C2)OC)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)