Products 143130-82-9
CAS 143130-82-9 appears in our catalog under these names: Dimethyl cis-stilbene-4,4'-dicarboxylate, 95%, Dimethyl cis-stilbene-4,4'-dicarboxylate . Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 250mg, 1g.
Methyl 4-[(Z)-2-(4-methoxycarbonylphenyl)ethenyl]benzoate (CAS 143130-82-9) is a chemical compound with the molecular formula C18H16O4 and a molecular weight of 296.3 g/mol. IUPAC name: methyl 4-[(Z)-2-(4-methoxycarbonylphenyl)ethenyl]benzoate. InChIKey: JOODVYOWCWQPMV-ARJAWSKDSA-N.
| Molecular formula | C18H16O4 |
|---|---|
| Molecular weight | 296.3 g/mol |
| IUPAC name | methyl 4-[(Z)-2-(4-methoxycarbonylphenyl)ethenyl]benzoate |
| InChIKey | JOODVYOWCWQPMV-ARJAWSKDSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)/C=C\C2=CC=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)