Products 2304621-31-4
CAS 2304621-31-4 appears in our catalog under these names: IMT1, IMT1/ 98.14% (existing batch purity), IMT1 98%, N,N-Dimethyl-2-((2-oxo-4-(o-tolyl)-2H-chromen-7-yl)oxy)propanamide, IMT1, 99.86%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 100mg, 200mg.
N,N-dimethyl-2-[4-(2-methylphenyl)-2-oxochromen-7-yl]oxypropanamide (CAS 2304621-31-4) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: N,N-dimethyl-2-[4-(2-methylphenyl)-2-oxochromen-7-yl]oxypropanamide. InChIKey: DBIPGWVTQBAHGP-UHFFFAOYSA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | N,N-dimethyl-2-[4-(2-methylphenyl)-2-oxochromen-7-yl]oxypropanamide |
| InChIKey | DBIPGWVTQBAHGP-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=CC(=O)OC3=C2C=CC(=C3)OC(C)C(=O)N(C)C |
Computed by PubChem (NCBI)