Products 52591-10-3
CAS 52591-10-3 appears in our catalog under these names: Iriflophenone, Iriflophenone/ 97.53% (existing batch purity), Iriflophenone, 98.05%, Iriflophenone (Standard), (4-Hydroxyphenyl)(2,4,6-trihydroxyphenyl)methanone, 99%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10mg, 5mg, 1mg, 25mg, 50mg, 100mg, 200mg, 10mM/1mL.
(4-hydroxyphenyl)-(2,4,6-trihydroxyphenyl)methanone (CAS 52591-10-3) is a chemical compound with the molecular formula C13H10O5 and a molecular weight of 246.21 g/mol. IUPAC name: (4-hydroxyphenyl)-(2,4,6-trihydroxyphenyl)methanone. InChIKey: AOJWDTJDEGSHOA-UHFFFAOYSA-N.
| Molecular formula | C13H10O5 |
|---|---|
| Molecular weight | 246.21 g/mol |
| IUPAC name | (4-hydroxyphenyl)-(2,4,6-trihydroxyphenyl)methanone |
| InChIKey | AOJWDTJDEGSHOA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=C(C=C(C=C2O)O)O)O |
Computed by PubChem (NCBI)