CAS 24168-96-5 appears in our catalog under these names: Isoconazole nitrate, 98%, Isoconazole Nitrate, Isoconazole Nitrate, >95% (HPLC), Isoconazole nitrate/ 99.73% (existing batch purity), Isoconazole nitrate. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, LoGiCal. Available pack sizes: 25g, 5g, 100g, 1g, on request, 100mg, 50mg, 250mg.
1-[2-(2,4-dichlorophenyl)-2-[(2,6-dichlorophenyl)methoxy]ethyl]imidazole;nitric acid (CAS 24168-96-5) is a chemical compound with the molecular formula C18H15Cl4N3O4 and a molecular weight of 479.1 g/mol. IUPAC name: 1-[2-(2,4-dichlorophenyl)-2-[(2,6-dichlorophenyl)methoxy]ethyl]imidazole;nitric acid. InChIKey: NNGQLSIGRSTLLU-UHFFFAOYSA-N.
| Molecular formula | C18H15Cl4N3O4 |
|---|---|
| Molecular weight | 479.1 g/mol |
| IUPAC name | 1-[2-(2,4-dichlorophenyl)-2-[(2,6-dichlorophenyl)methoxy]ethyl]imidazole;nitric acid |
| InChIKey | NNGQLSIGRSTLLU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)COC(CN2C=CN=C2)C3=C(C=C(C=C3)Cl)Cl)Cl.[N+](=O)(O)[O-] |
Computed by PubChem (NCBI)