cas: 64622-17-9 — see every product listed under this CAS number, including other names
Isopropyl 2-(4-isobutylphenyl)propanoate, 97% (CAS 64622-17-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F693193-100MG |
| cas | 64622-17-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 221.81 Pln | |
| Fluorochem | 250mg | 325.94 Pln | |
| Fluorochem | 1g | 747.67 Pln | |
| Fluorochem | 5g | 2434.58 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Propan-2-yl 2-[4-(2-methylpropyl)phenyl]propanoate (CAS 64622-17-9) is a chemical compound with the molecular formula C16H24O2 and a molecular weight of 248.36 g/mol. IUPAC name: propan-2-yl 2-[4-(2-methylpropyl)phenyl]propanoate. InChIKey: RVZWLHIFEPTVBC-UHFFFAOYSA-N.
| Molecular formula | C16H24O2 |
|---|---|
| Molecular weight | 248.36 g/mol |
| IUPAC name | propan-2-yl 2-[4-(2-methylpropyl)phenyl]propanoate |
| InChIKey | RVZWLHIFEPTVBC-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC=C(C=C1)C(C)C(=O)OC(C)C |
Computed by PubChem (NCBI)