CAS 1114975-39-1 is the registry number for Dexibuprofen Isopropyl Ester. Offered by: Mikromol. Available pack sizes: 100mg.
Propan-2-yl (2S)-2-[4-(2-methylpropyl)phenyl]propanoate (CAS 1114975-39-1) is a chemical compound with the molecular formula C16H24O2 and a molecular weight of 248.36 g/mol. IUPAC name: propan-2-yl (2S)-2-[4-(2-methylpropyl)phenyl]propanoate. InChIKey: RVZWLHIFEPTVBC-ZDUSSCGKSA-N.
| Molecular formula | C16H24O2 |
|---|---|
| Molecular weight | 248.36 g/mol |
| IUPAC name | propan-2-yl (2S)-2-[4-(2-methylpropyl)phenyl]propanoate |
| InChIKey | RVZWLHIFEPTVBC-ZDUSSCGKSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)CC(C)C)C(=O)OC(C)C |
Computed by PubChem (NCBI)