CAS 1628557-04-9 appears in our catalog under these names: Isoquinolin-3-ylmethanamine hydrochloride, 97%, Isoquinolin-3-ylmethanamine hydrochloride, 97%, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
Isoquinolin-3-ylmethanamine;hydrochloride (CAS 1628557-04-9) is a chemical compound with the molecular formula C10H11ClN2 and a molecular weight of 194.66 g/mol. IUPAC name: isoquinolin-3-ylmethanamine;hydrochloride. InChIKey: DZPYZGKIJXRUOZ-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2 |
|---|---|
| Molecular weight | 194.66 g/mol |
| IUPAC name | isoquinolin-3-ylmethanamine;hydrochloride |
| InChIKey | DZPYZGKIJXRUOZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=NC(=CC2=C1)CN.Cl |
Computed by PubChem (NCBI)