Isoquinolin-5-ylboronic acid hydrochloride, 95%
cas: 1256345-46-6 — see every product listed under this CAS number, including other names
Isoquinolin-5-ylboronic acid hydrochloride, 95% (CAS 1256345-46-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F224439-100MG |
| cas | 1256345-46-6 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 331.15 Pln | |
| Fluorochem | 250mg | 508.17 Pln | |
| Fluorochem | 1g | 1216.26 Pln | |
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 704.12 Pln | |
| Ambeed | 5g | 1972.38 Pln | |
| BLDpharm | 100mg | 269.93 Pln | |
| BLDpharm | 250mg | 353.23 Pln | |
| BLDpharm | 1g | 753.09 Pln | |
| BLDpharm | 5g | 2124.83 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
Isoquinolin-5-ylboronic acid;hydrochloride (CAS 1256345-46-6) is a chemical compound with the molecular formula C9H9BClNO2 and a molecular weight of 209.44 g/mol. IUPAC name: isoquinolin-5-ylboronic acid;hydrochloride. InChIKey: BCHKZJGKVPKAJO-UHFFFAOYSA-N.
| Molecular formula | C9H9BClNO2 |
|---|---|
| Molecular weight | 209.44 g/mol |
| IUPAC name | isoquinolin-5-ylboronic acid;hydrochloride |
| InChIKey | BCHKZJGKVPKAJO-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=CN=CC2=CC=C1)(O)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
Isoquinolin-5-ylboronic acid hydrochloride, Isoquinoline-5-boronic acid, HCl, Isoquinoline-5-boronic acid HCl, Isoquinoline-5-boronic acid hydrochloride, isoquinolin-5-ylboronic acid;hydrochloride, (isoquinolin-5-yl)boronic acid hydrochloride, Isoquinolin-5-ylboronicacidhydrochloride, isoquinolin-5-yl-5-boronic acid hydrochloride, Isoquinolin-5-ylboronic acid--hydrogen chloride (1/1)