cas: 1256345-46-6 — see every product listed under this CAS number, including other names
Isoquinolin-5-ylboronic acid hydrochloride, 95% (CAS 1256345-46-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F224439-100MG |
| cas | 1256345-46-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1153.78 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Isoquinolin-5-ylboronic acid;hydrochloride (CAS 1256345-46-6) is a chemical compound with the molecular formula C9H9BClNO2 and a molecular weight of 209.44 g/mol. IUPAC name: isoquinolin-5-ylboronic acid;hydrochloride. InChIKey: BCHKZJGKVPKAJO-UHFFFAOYSA-N.
| Molecular formula | C9H9BClNO2 |
|---|---|
| Molecular weight | 209.44 g/mol |
| IUPAC name | isoquinolin-5-ylboronic acid;hydrochloride |
| InChIKey | BCHKZJGKVPKAJO-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=CN=CC2=CC=C1)(O)O.Cl |
Computed by PubChem (NCBI)