CAS 677702-23-7 appears in our catalog under these names: 4–Isoquinolineboronic acid hydrochloride, Isoquinoline-4-boronic acid hydrochloride, 97%, 97%, ISOQUINOLINE-4-BORONIC ACID HCL, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
Isoquinolin-4-ylboronic acid;hydrochloride (CAS 677702-23-7) is a chemical compound with the molecular formula C9H9BClNO2 and a molecular weight of 209.44 g/mol. IUPAC name: isoquinolin-4-ylboronic acid;hydrochloride. InChIKey: KVBIOGMRHMKPFZ-UHFFFAOYSA-N.
| Molecular formula | C9H9BClNO2 |
|---|---|
| Molecular weight | 209.44 g/mol |
| IUPAC name | isoquinolin-4-ylboronic acid;hydrochloride |
| InChIKey | KVBIOGMRHMKPFZ-UHFFFAOYSA-N |
| SMILES | B(C1=CN=CC2=CC=CC=C12)(O)O.Cl |
Computed by PubChem (NCBI)