cas: 685103-98-4 — see every product listed under this CAS number, including other names
Isoquinoline-4-boronic acid pinacol ester, 97%, 97% (CAS 685103-98-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FAHB-100mg |
| cas | 685103-98-4 |
| size | 100mg |
| availability | 43.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 434.00 Pln | |
| Chemat | 10g | 736.40 Pln | |
| Chemat | 25g | 1576.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline (CAS 685103-98-4) is a chemical compound with the molecular formula C15H18BNO2 and a molecular weight of 255.12 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline. InChIKey: LOMKRPABAXIQJL-UHFFFAOYSA-N.
| Molecular formula | C15H18BNO2 |
|---|---|
| Molecular weight | 255.12 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline |
| InChIKey | LOMKRPABAXIQJL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=CC3=CC=CC=C23 |
Computed by PubChem (NCBI)